About tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid
tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 160837706) has the molecular formula C13H19ClN2O6S
and a molecular weight of 366.82 g/mol. Its IUPAC name is tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 160837706 |
| Molecular Formula | C13H19ClN2O6S |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1nc(Cl)sc1C(=O)O.CC(C)(C)ON=O |
| InChI | InChI=1S/C9H10ClNO4S.C4H9NO2/c1-9(2,3)15-7(14)4-5(6(12)13)16-8(10)11-4;1-4(2,3)7-5-6/h1-3H3,(H,12,13);1-3H3 |
| InChIKey | SHPUIIFWDIJHKV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid (CID 160837706) is tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid is CC(C)(C)OC(=O)c1nc(Cl)sc1C(=O)O.CC(C)(C)ON=O.
What is the InChIKey of tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is SHPUIIFWDIJHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO4S.C4H9NO2/c1-9(2,3)15-7(14)4-5(6(12)13)16-8(10)11-4;1-4(2,3)7-5-6/h1-3H3,(H,12,13);1-3H3.
What are the key properties of tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid?
tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 366.82 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl nitrite;2-chloro-4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 160837706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).