About (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one
(3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one (PubChem CID 160839342) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one.
Molecular Properties
| Compound Name | (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one |
| PubChem CID | 160839342 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one |
| SMILES | CC(C)C[C@@H](C)C(=O)COCCCCCCN |
| InChI | InChI=1S/C14H29NO2/c1-12(2)10-13(3)14(16)11-17-9-7-5-4-6-8-15/h12-13H,4-11,15H2,1-3H3/t13-/m1/s1 |
| InChIKey | SHVAPGQHQBNYRY-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one?
The IUPAC name of (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one (CID 160839342) is (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one.
What is the SMILES notation for (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one?
The canonical SMILES for (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one is CC(C)C[C@@H](C)C(=O)COCCCCCCN.
What is the InChIKey of (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one?
The InChIKey is SHVAPGQHQBNYRY-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H29NO2/c1-12(2)10-13(3)14(16)11-17-9-7-5-4-6-8-15/h12-13H,4-11,15H2,1-3H3/t13-/m1/s1.
What are the key properties of (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one?
(3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one has a molecular weight of 243.39 g/mol, XLogP of 2.77, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(6-aminohexoxy)-3,5-dimethylhexan-2-one is sourced from PubChem (CID 160839342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).