C21H18N6 — CID 16084
2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 16084) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 16084 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H18N6/c1-4-10-16(11-5-1)22-19-25-20(23-17-12-6-2-7-13-17)27-21(26-19)24-18-14-8-3-9-15-18/h1-15H,(H3,22,23,24,25,26,27) |
| InChIKey | GGHBKCSNURXPNB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |