C56H12N2O — CID 160840351
4-(furan-3-yl)-1H-benzimidazole;pentatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43-docosayne (PubChem CID 160840351) has the molecular formula C56H12N2O and a molecular weight of 728.73 g/mol. Its IUPAC name is 4-(furan-3-yl)-1H-benzimidazole;pentatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43-docosayne.
| Compound Name | 4-(furan-3-yl)-1H-benzimidazole;pentatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43-docosayne |
|---|---|
| PubChem CID | 160840351 |
| Molecular Formula | C56H12N2O |
| Molecular Weight | 728.73 g/mol |
| Exact Mass | 728.09 |
| IUPAC Name | 4-(furan-3-yl)-1H-benzimidazole;pentatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43-docosayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.c1cc(-c2ccoc2)c2nc[nH]c2c1 |
| InChI | InChI=1S/C45H4.C11H8N2O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-2-9(8-4-5-14-6-8)11-10(3-1)12-7-13-11/h1H,2H3;1-7H,(H,12,13) |
| InChIKey | SHYHVOUTWVYQEC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|