About 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane
4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane (PubChem CID 160840726) has the molecular formula C8H17N2O3PS
and a molecular weight of 252.28 g/mol. Its IUPAC name is 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane.
Molecular Properties
| Compound Name | 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane |
| PubChem CID | 160840726 |
| Molecular Formula | C8H17N2O3PS |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane |
| SMILES | C.CCOP(C)(=O)OCc1csc(N)n1 |
| InChI | InChI=1S/C7H13N2O3PS.CH4/c1-3-11-13(2,10)12-4-6-5-14-7(8)9-6;/h5H,3-4H2,1-2H3,(H2,8,9);1H4 |
| InChIKey | SHZKNNNOOMMALD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane?
The IUPAC name of 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane (CID 160840726) is 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane.
What is the SMILES notation for 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane?
The canonical SMILES for 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane is C.CCOP(C)(=O)OCc1csc(N)n1.
What is the InChIKey of 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane?
The InChIKey is SHZKNNNOOMMALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2O3PS.CH4/c1-3-11-13(2,10)12-4-6-5-14-7(8)9-6;/h5H,3-4H2,1-2H3,(H2,8,9);1H4.
What are the key properties of 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane?
4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane has a molecular weight of 252.28 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[ethoxy(methyl)phosphoryl]oxymethyl]-1,3-thiazol-2-amine;methane is sourced from PubChem (CID 160840726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).