C28H31N5O3S3 — CID 160842077
N-[(1S,2S)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane (PubChem CID 160842077) has the molecular formula C28H31N5O3S3 and a molecular weight of 581.79 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane.
| Compound Name | N-[(1S,2S)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 160842077 |
| Molecular Formula | C28H31N5O3S3 |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)N[C@H]3CCCC[C@@H]3N)sc3nccc1c23.S.S |
| InChI | InChI=1S/C28H27N5O3S.2H2S/c1-16-15-18(36-17-7-3-2-4-8-17)11-12-21(16)33-22-13-14-30-27-23(22)24(32-28(33)35)25(37-27)26(34)31-20-10-6-5-9-19(20)29;;/h2-4,7-8,11-15,19-20H,5-6,9-10,29H2,1H3,(H,31,34)(H,32,35);2*1H2/t19-,20-;;/m0../s1 |
| InChIKey | SIDUVGYYVVTOFQ-TULUPMBKSA-N |
| XLogP | 6.31 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |