C36H55N3O6 — CID 160843672
methyl 3-[(2S,5S)-2-[[(2R)-2-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4,4-dimethylpentanoyl]amino]-5-ethyl-6-oxoheptyl]-5-methoxyindole-1-carboxylate (PubChem CID 160843672) has the molecular formula C36H55N3O6 and a molecular weight of 625.85 g/mol. Its IUPAC name is methyl 3-[(2S,5S)-2-[[(2R)-2-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4,4-dimethylpentanoyl]amino]-5-ethyl-6-oxoheptyl]-5-methoxyindole-1-carboxylate.
| Compound Name | methyl 3-[(2S,5S)-2-[[(2R)-2-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4,4-dimethylpentanoyl]amino]-5-ethyl-6-oxoheptyl]-5-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 160843672 |
| Molecular Formula | C36H55N3O6 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.41 |
| IUPAC Name | methyl 3-[(2S,5S)-2-[[(2R)-2-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4,4-dimethylpentanoyl]amino]-5-ethyl-6-oxoheptyl]-5-methoxyindole-1-carboxylate |
| SMILES | CC[C@@H](CC[C@@H](Cc1cn(C(=O)OC)c2ccc(OC)cc12)NC(=O)[C@@H](CC(=O)N1[C@H](C)CCC[C@@H]1C)CC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C36H55N3O6/c1-10-26(25(4)40)14-15-29(18-28-22-38(35(43)45-9)32-17-16-30(44-8)20-31(28)32)37-34(42)27(21-36(5,6)7)19-33(41)39-23(2)12-11-13-24(39)3/h16-17,20,22-24,26-27,29H,10-15,18-19,21H2,1-9H3,(H,37,42)/t23-,24+,26-,27-,29-/m0/s1 |
| InChIKey | HQTFDSGZAQWRAQ-NSZWWNRUSA-N |
| XLogP | 6.92 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |