C24H29ClF3N3O4 — CID 160843784
butanedioic acid;7-chloro-N-[[4-[(2,2,2-trifluoroethylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine (PubChem CID 160843784) has the molecular formula C24H29ClF3N3O4 and a molecular weight of 515.96 g/mol. Its IUPAC name is butanedioic acid;7-chloro-N-[[4-[(2,2,2-trifluoroethylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine.
| Compound Name | butanedioic acid;7-chloro-N-[[4-[(2,2,2-trifluoroethylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
|---|---|
| PubChem CID | 160843784 |
| Molecular Formula | C24H29ClF3N3O4 |
| Molecular Weight | 515.96 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | butanedioic acid;7-chloro-N-[[4-[(2,2,2-trifluoroethylamino)methyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
| SMILES | FC(F)(F)CNCc1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C20H23ClF3N3.C4H6O4/c21-18-6-5-16-7-9-25-10-8-17(16)19(18)27-12-15-3-1-14(2-4-15)11-26-13-20(22,23)24;5-3(6)1-2-4(7)8/h1-6,25-27H,7-13H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | SIJIUTQKDQDPNL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |