C20H16N6 — CID 160845167
N-[2-[(3-isocyanophenyl)methyl]pyrimidin-4-yl]-2-methyl-3H-benzimidazol-5-amine (PubChem CID 160845167) has the molecular formula C20H16N6 and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[2-[(3-isocyanophenyl)methyl]pyrimidin-4-yl]-2-methyl-3H-benzimidazol-5-amine.
| Compound Name | N-[2-[(3-isocyanophenyl)methyl]pyrimidin-4-yl]-2-methyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 160845167 |
| Molecular Formula | C20H16N6 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[2-[(3-isocyanophenyl)methyl]pyrimidin-4-yl]-2-methyl-3H-benzimidazol-5-amine |
| SMILES | [C-]#[N+]c1cccc(Cc2nccc(Nc3ccc4nc(C)[nH]c4c3)n2)c1 |
| InChI | InChI=1S/C20H16N6/c1-13-23-17-7-6-16(12-18(17)24-13)25-19-8-9-22-20(26-19)11-14-4-3-5-15(10-14)21-2/h3-10,12H,11H2,1H3,(H,23,24)(H,22,25,26) |
| InChIKey | ZFMYLDUEWYBSPT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|