About 1H-indazole;thiophene
1H-indazole;thiophene (PubChem CID 160845490) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 1H-indazole;thiophene.
Molecular Properties
| Compound Name | 1H-indazole;thiophene |
| PubChem CID | 160845490 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1H-indazole;thiophene |
| SMILES | c1ccc2[nH]ncc2c1.c1ccsc1 |
| InChI | InChI=1S/C7H6N2.C4H4S/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-5-3-1/h1-5H,(H,8,9);1-4H |
| InChIKey | SIOXYLXZCVBHNW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;thiophene?
The IUPAC name of 1H-indazole;thiophene (CID 160845490) is 1H-indazole;thiophene.
What is the SMILES notation for 1H-indazole;thiophene?
The canonical SMILES for 1H-indazole;thiophene is c1ccc2[nH]ncc2c1.c1ccsc1.
What is the InChIKey of 1H-indazole;thiophene?
The InChIKey is SIOXYLXZCVBHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C4H4S/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-5-3-1/h1-5H,(H,8,9);1-4H.
What are the key properties of 1H-indazole;thiophene?
1H-indazole;thiophene has a molecular weight of 202.28 g/mol, XLogP of 3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;thiophene is sourced from PubChem (CID 160845490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).