C14H22N2O5S3 — CID 160845689
1-[(6S)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]piperidin-2-one;sulfane (PubChem CID 160845689) has the molecular formula C14H22N2O5S3 and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-[(6S)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]piperidin-2-one;sulfane.
| Compound Name | 1-[(6S)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]piperidin-2-one;sulfane |
|---|---|
| PubChem CID | 160845689 |
| Molecular Formula | C14H22N2O5S3 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[(6S)-6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl]piperidin-2-one;sulfane |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])sc2C(N2CCCCC2=O)[C@@H]1O.S.S |
| InChI | InChI=1S/C14H18N2O5S.2H2S/c1-14(2)13(18)11(15-6-4-3-5-9(15)17)12-8(21-14)7-10(22-12)16(19)20;;/h7,11,13,18H,3-6H2,1-2H3;2*1H2/t11?,13-;;/m0../s1 |
| InChIKey | SIPOKROMBRWBJV-UAAMANLASA-N |
| XLogP | 2.47 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|