C17H20N2O2 — CID 160846113
4-methylcyclohexa-1,5-diene-1,4-diamine;naphthalene-1,5-diol (PubChem CID 160846113) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-methylcyclohexa-1,5-diene-1,4-diamine;naphthalene-1,5-diol.
| Compound Name | 4-methylcyclohexa-1,5-diene-1,4-diamine;naphthalene-1,5-diol |
|---|---|
| PubChem CID | 160846113 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-methylcyclohexa-1,5-diene-1,4-diamine;naphthalene-1,5-diol |
| SMILES | CC1(N)C=CC(N)=CC1.Oc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C10H8O2.C7H12N2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;1-7(9)4-2-6(8)3-5-7/h1-6,11-12H;2-4H,5,8-9H2,1H3 |
| InChIKey | SIQXWMISEBWNTD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |