C49H38N4 — CID 160846132
5-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole;methane (PubChem CID 160846132) has the molecular formula C49H38N4 and a molecular weight of 682.87 g/mol. Its IUPAC name is 5-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole;methane.
| Compound Name | 5-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole;methane |
|---|---|
| PubChem CID | 160846132 |
| Molecular Formula | C49H38N4 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 5-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole;methane |
| SMILES | C.CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-c5cccc(-c6ccccc6)c5)n4)c3cc21 |
| InChI | InChI=1S/C48H34N4.CH4/c1-48(2)41-25-11-9-23-37(41)39-29-40-38-24-10-12-26-43(38)52(44(40)30-42(39)48)47-50-45(35-21-13-19-33(27-35)31-15-5-3-6-16-31)49-46(51-47)36-22-14-20-34(28-36)32-17-7-4-8-18-32;/h3-30H,1-2H3;1H4 |
| InChIKey | SIQZLSHRFHRHJS-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |