C14H14N2 — CID 160846194
3,4,11-trimethyl-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 160846194) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3,4,11-trimethyl-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 3,4,11-trimethyl-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 160846194 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3,4,11-trimethyl-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | Cc1ccc2c(n1)Cc1cnc(C)c(C)c1-2 |
| InChI | InChI=1S/C14H14N2/c1-8-4-5-12-13(16-8)6-11-7-15-10(3)9(2)14(11)12/h4-5,7H,6H2,1-3H3 |
| InChIKey | ILIANHLHFVWEDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |