C28H30N8 — CID 160847165
2-[4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]phenyl]-5-ethyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 160847165) has the molecular formula C28H30N8 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-[4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]phenyl]-5-ethyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-[4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]phenyl]-5-ethyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 160847165 |
| Molecular Formula | C28H30N8 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]phenyl]-5-ethyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CCN1CCc2nc(-c3ccc(-c4nc(Cc5ccc6[nH]ncc6c5C5CC5)n(C)n4)cc3)[nH]c2C1 |
| InChI | InChI=1S/C28H30N8/c1-3-36-13-12-23-24(16-36)31-27(30-23)18-6-8-19(9-7-18)28-32-25(35(2)34-28)14-20-10-11-22-21(15-29-33-22)26(20)17-4-5-17/h6-11,15,17H,3-5,12-14,16H2,1-2H3,(H,29,33)(H,30,31) |
| InChIKey | SIUCPSAJKHPCSR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |