About 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate
6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 160848537) has the molecular formula C19H25BrN2O2
and a molecular weight of 393.33 g/mol. Its IUPAC name is 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 160848537 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | Brc1ccc2nc[nH]c2c1.CC(C)(C)OC(=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H20O2.C7H5BrN2/c1-12(2,3)14-11(13)10-7-8-4-5-9(10)6-8;8-5-1-2-6-7(3-5)10-4-9-6/h8-10H,4-7H2,1-3H3;1-4H,(H,9,10) |
| InChIKey | SIYNMWGFCLDHEE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate (CID 160848537) is 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate is Brc1ccc2nc[nH]c2c1.CC(C)(C)OC(=O)C1CC2CCC1C2.
What is the InChIKey of 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is SIYNMWGFCLDHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C7H5BrN2/c1-12(2,3)14-11(13)10-7-8-4-5-9(10)6-8;8-5-1-2-6-7(3-5)10-4-9-6/h8-10H,4-7H2,1-3H3;1-4H,(H,9,10).
What are the key properties of 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate?
6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 393.33 g/mol, XLogP of 5.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-benzimidazole;tert-butyl bicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 160848537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).