C32H60O2 — CID 160849001
bis((E)-2,2,6,6-tetramethylhept-4-en-3-one);(E)-2,2,5,5-tetramethylhex-3-ene (PubChem CID 160849001) has the molecular formula C32H60O2 and a molecular weight of 476.83 g/mol. Its IUPAC name is bis((E)-2,2,6,6-tetramethylhept-4-en-3-one);(E)-2,2,5,5-tetramethylhex-3-ene.
| Compound Name | bis((E)-2,2,6,6-tetramethylhept-4-en-3-one);(E)-2,2,5,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 160849001 |
| Molecular Formula | C32H60O2 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.46 |
| IUPAC Name | bis((E)-2,2,6,6-tetramethylhept-4-en-3-one);(E)-2,2,5,5-tetramethylhex-3-ene |
| SMILES | CC(C)(C)/C=C/C(=O)C(C)(C)C.CC(C)(C)/C=C/C(=O)C(C)(C)C.CC(C)(C)/C=C/C(C)(C)C |
| InChI | InChI=1S/2C11H20O.C10H20/c2*1-10(2,3)8-7-9(12)11(4,5)6;1-9(2,3)7-8-10(4,5)6/h2*7-8H,1-6H3;7-8H,1-6H3/b3*8-7+ |
| InChIKey | SJAASLUANVVUQM-SLDMBMQTSA-N |
| XLogP | 10.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|