About methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate
methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate (PubChem CID 160849225) has the molecular formula C21H14Cl3F3N2O4
and a molecular weight of 521.71 g/mol. Its IUPAC name is methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate |
| PubChem CID | 160849225 |
| Molecular Formula | C21H14Cl3F3N2O4 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(-c2ccc(C(F)(F)F)cc2)cc1Cl.COC(=O)c1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9ClF3NO2.C7H5Cl2NO2/c1-21-13(20)10-7-19-12(6-11(10)15)8-2-4-9(5-3-8)14(16,17)18;1-12-7(11)4-3-10-6(9)2-5(4)8/h2-7H,1H3;2-3H,1H3 |
| InChIKey | SJARIIFNWUWOQB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate?
The IUPAC name of methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate (CID 160849225) is methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate.
What is the SMILES notation for methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate?
The canonical SMILES for methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate is COC(=O)c1cnc(-c2ccc(C(F)(F)F)cc2)cc1Cl.COC(=O)c1cnc(Cl)cc1Cl.
What is the InChIKey of methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate?
The InChIKey is SJARIIFNWUWOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF3NO2.C7H5Cl2NO2/c1-21-13(20)10-7-19-12(6-11(10)15)8-2-4-9(5-3-8)14(16,17)18;1-12-7(11)4-3-10-6(9)2-5(4)8/h2-7H,1H3;2-3H,1H3.
What are the key properties of methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate?
methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate has a molecular weight of 521.71 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate;methyl 4,6-dichloropyridine-3-carboxylate is sourced from PubChem (CID 160849225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).