C23H28N8O — CID 160849457
5-amino-1-[8-propan-2-yl-4-[(2-pyrazol-1-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]pentan-1-one (PubChem CID 160849457) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 5-amino-1-[8-propan-2-yl-4-[(2-pyrazol-1-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]pentan-1-one.
| Compound Name | 5-amino-1-[8-propan-2-yl-4-[(2-pyrazol-1-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 160849457 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 5-amino-1-[8-propan-2-yl-4-[(2-pyrazol-1-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]pentan-1-one |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3-n3cccn3)nc(C(=O)CCCCN)nc12 |
| InChI | InChI=1S/C23H28N8O/c1-16(2)18-15-27-31-22(18)28-21(20(32)10-5-6-11-24)29-23(31)25-14-17-8-3-4-9-19(17)30-13-7-12-26-30/h3-4,7-9,12-13,15-16H,5-6,10-11,14,24H2,1-2H3,(H,25,28,29) |
| InChIKey | SJBKIVZPKJPPAI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|