About 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine
2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine (PubChem CID 160849656) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine.
Molecular Properties
| Compound Name | 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine |
| PubChem CID | 160849656 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine |
| SMILES | CCNCC(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C14H19N/c1-2-15-11-14(12-7-3-4-8-12)13-9-5-6-10-13/h3-10,12-15H,2,11H2,1H3 |
| InChIKey | GJNIDJCOQONNEK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine?
The IUPAC name of 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine (CID 160849656) is 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine.
What is the SMILES notation for 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine?
The canonical SMILES for 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine is CCNCC(C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine?
The InChIKey is GJNIDJCOQONNEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-15-11-14(12-7-3-4-8-12)13-9-5-6-10-13/h3-10,12-15H,2,11H2,1H3.
What are the key properties of 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine?
2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine has a molecular weight of 201.31 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-di(cyclopenta-2,4-dien-1-yl)-N-ethylethanamine is sourced from PubChem (CID 160849656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).