C16H32N4O6S2 — CID 160850063
(2S)-N,N-dimethyl-2-sulfamoylhex-5-enamide;(2R)-N,N-dimethyl-2-sulfamoylhex-5-enamide (PubChem CID 160850063) has the molecular formula C16H32N4O6S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-sulfamoylhex-5-enamide;(2R)-N,N-dimethyl-2-sulfamoylhex-5-enamide.
| Compound Name | (2S)-N,N-dimethyl-2-sulfamoylhex-5-enamide;(2R)-N,N-dimethyl-2-sulfamoylhex-5-enamide |
|---|---|
| PubChem CID | 160850063 |
| Molecular Formula | C16H32N4O6S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2S)-N,N-dimethyl-2-sulfamoylhex-5-enamide;(2R)-N,N-dimethyl-2-sulfamoylhex-5-enamide |
| SMILES | C=CCC[C@@H](C(=O)N(C)C)S(N)(=O)=O.C=CCC[C@H](C(=O)N(C)C)S(N)(=O)=O |
| InChI | InChI=1S/2C8H16N2O3S/c2*1-4-5-6-7(14(9,12)13)8(11)10(2)3/h2*4,7H,1,5-6H2,2-3H3,(H2,9,12,13)/t2*7-/m10/s1 |
| InChIKey | SJDJNKJOUBIUPV-UNLCMTKJSA-N |
| XLogP | -0.60 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|