About disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate
disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate (PubChem CID 160850960) has the molecular formula C12H7BrFNNa2O3
and a molecular weight of 358.07 g/mol. Its IUPAC name is disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate.
Molecular Properties
| Compound Name | disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate |
| PubChem CID | 160850960 |
| Molecular Formula | C12H7BrFNNa2O3 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate |
| SMILES | Fc1cc(-c2ccncc2)ccc1Br.O=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H7BrFN.CH2O3.2Na/c12-10-2-1-9(7-11(10)13)8-3-5-14-6-4-8;2-1(3)4;;/h1-7H;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | SJGGTECZCHQRHW-UHFFFAOYSA-L |
| XLogP | -4.79 |
| TPSA | 76.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate?
The IUPAC name of disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate (CID 160850960) is disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate.
What is the SMILES notation for disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate?
The canonical SMILES for disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate is Fc1cc(-c2ccncc2)ccc1Br.O=C([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate?
The InChIKey is SJGGTECZCHQRHW-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H7BrFN.CH2O3.2Na/c12-10-2-1-9(7-11(10)13)8-3-5-14-6-4-8;2-1(3)4;;/h1-7H;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate?
disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate has a molecular weight of 358.07 g/mol, XLogP of -4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-(4-bromo-3-fluorophenyl)pyridine;carbonate is sourced from PubChem (CID 160850960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).