C20H26N6O2 — CID 160851334
(3E)-3-[[7-(cyclopropylamino)-5-[[(1R)-1-cyclopropylethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione;methane (PubChem CID 160851334) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is (3E)-3-[[7-(cyclopropylamino)-5-[[(1R)-1-cyclopropylethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione;methane.
| Compound Name | (3E)-3-[[7-(cyclopropylamino)-5-[[(1R)-1-cyclopropylethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione;methane |
|---|---|
| PubChem CID | 160851334 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (3E)-3-[[7-(cyclopropylamino)-5-[[(1R)-1-cyclopropylethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione;methane |
| SMILES | C.C[C@@H](Nc1cc(NC2CC2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1)C1CC1 |
| InChI | InChI=1S/C19H22N6O2.CH4/c1-10(11-2-3-11)21-15-8-16(22-14-4-5-14)25-18(23-15)13(9-20-25)6-12-7-17(26)24-19(12)27;/h6,8-11,14,22H,2-5,7H2,1H3,(H,21,23)(H,24,26,27);1H4/b12-6+;/t10-;/m1./s1 |
| InChIKey | SJHLBYAHYTWBNU-XMXJIAKPSA-N |
| XLogP | 2.58 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|