About 2-aminonaphthalene-1,4-dione;perylene
2-aminonaphthalene-1,4-dione;perylene (PubChem CID 160852881) has the molecular formula C30H19NO2
and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-aminonaphthalene-1,4-dione;perylene.
Molecular Properties
| Compound Name | 2-aminonaphthalene-1,4-dione;perylene |
| PubChem CID | 160852881 |
| Molecular Formula | C30H19NO2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-aminonaphthalene-1,4-dione;perylene |
| SMILES | NC1=CC(=O)c2ccccc2C1=O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C10H7NO2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-12H;1-5H,11H2 |
| InChIKey | SJMJVYWUVRBHPF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-aminonaphthalene-1,4-dione;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminonaphthalene-1,4-dione;perylene?
The IUPAC name of 2-aminonaphthalene-1,4-dione;perylene (CID 160852881) is 2-aminonaphthalene-1,4-dione;perylene.
What is the SMILES notation for 2-aminonaphthalene-1,4-dione;perylene?
The canonical SMILES for 2-aminonaphthalene-1,4-dione;perylene is NC1=CC(=O)c2ccccc2C1=O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of 2-aminonaphthalene-1,4-dione;perylene?
The InChIKey is SJMJVYWUVRBHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C10H7NO2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-12H;1-5H,11H2.
What are the key properties of 2-aminonaphthalene-1,4-dione;perylene?
2-aminonaphthalene-1,4-dione;perylene has a molecular weight of 425.49 g/mol, XLogP of 6.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminonaphthalene-1,4-dione;perylene is sourced from PubChem (CID 160852881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).