C48H44Br3N5O6 — CID 160853154
1,4-bis(5-bromo-1H-indol-3-yl)pentane-1,2-dione;tert-butyl N-[2-(5-bromo-1H-indol-3-yl)-5-(5-methyl-1H-indol-3-yl)-4,5-dioxopentyl]carbamate (PubChem CID 160853154) has the molecular formula C48H44Br3N5O6 and a molecular weight of 1026.62 g/mol. Its IUPAC name is 1,4-bis(5-bromo-1H-indol-3-yl)pentane-1,2-dione;tert-butyl N-[2-(5-bromo-1H-indol-3-yl)-5-(5-methyl-1H-indol-3-yl)-4,5-dioxopentyl]carbamate.
| Compound Name | 1,4-bis(5-bromo-1H-indol-3-yl)pentane-1,2-dione;tert-butyl N-[2-(5-bromo-1H-indol-3-yl)-5-(5-methyl-1H-indol-3-yl)-4,5-dioxopentyl]carbamate |
|---|---|
| PubChem CID | 160853154 |
| Molecular Formula | C48H44Br3N5O6 |
| Molecular Weight | 1026.62 g/mol |
| Exact Mass | 1023.08 |
| IUPAC Name | 1,4-bis(5-bromo-1H-indol-3-yl)pentane-1,2-dione;tert-butyl N-[2-(5-bromo-1H-indol-3-yl)-5-(5-methyl-1H-indol-3-yl)-4,5-dioxopentyl]carbamate |
| SMILES | CC(CC(=O)C(=O)c1c[nH]c2ccc(Br)cc12)c1c[nH]c2ccc(Br)cc12.Cc1ccc2[nH]cc(C(=O)C(=O)CC(CNC(=O)OC(C)(C)C)c3c[nH]c4ccc(Br)cc34)c2c1 |
| InChI | InChI=1S/C27H28BrN3O4.C21H16Br2N2O2/c1-15-5-7-22-18(9-15)21(14-30-22)25(33)24(32)10-16(12-31-26(34)35-27(2,3)4)20-13-29-23-8-6-17(28)11-19(20)23;1-11(16-9-24-18-4-2-12(22)7-14(16)18)6-20(26)21(27)17-10-25-19-5-3-13(23)8-15(17)19/h5-9,11,13-14,16,29-30H,10,12H2,1-4H3,(H,31,34);2-5,7-11,24-25H,6H2,1H3 |
| InChIKey | SJNHEAOMGFXUAC-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.62 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|