C26H36O15S — CID 160853266
6-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl)methyl acetate (PubChem CID 160853266) has the molecular formula C26H36O15S and a molecular weight of 620.63 g/mol. Its IUPAC name is 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl)methyl acetate.
| Compound Name | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 160853266 |
| Molecular Formula | C26H36O15S |
| Molecular Weight | 620.63 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2ccccc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C20H24O9S.C6H12O6/c1-11(21)25-10-16-17(26-12(2)22)18(27-13(3)23)19(28-14(4)24)20(29-16)30-15-8-6-5-7-9-15;7-1-2-3(8)4(9)5(10)6(11)12-2/h5-9,16-20H,10H2,1-4H3;2-11H,1H2 |
| InChIKey | SJNRTLDPBDGFHF-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 224.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.63 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|