C29H41BBr2N6O2 — CID 160853292
5-bromo-N-(cyclohexylmethyl)pyridin-2-amine;5-bromopyridin-2-amine;[6-(cyclohexylmethylamino)-3-pyridinyl]boronic acid (PubChem CID 160853292) has the molecular formula C29H41BBr2N6O2 and a molecular weight of 676.31 g/mol. Its IUPAC name is 5-bromo-N-(cyclohexylmethyl)pyridin-2-amine;5-bromopyridin-2-amine;[6-(cyclohexylmethylamino)-3-pyridinyl]boronic acid.
| Compound Name | 5-bromo-N-(cyclohexylmethyl)pyridin-2-amine;5-bromopyridin-2-amine;[6-(cyclohexylmethylamino)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 160853292 |
| Molecular Formula | C29H41BBr2N6O2 |
| Molecular Weight | 676.31 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | 5-bromo-N-(cyclohexylmethyl)pyridin-2-amine;5-bromopyridin-2-amine;[6-(cyclohexylmethylamino)-3-pyridinyl]boronic acid |
| SMILES | Brc1ccc(NCC2CCCCC2)nc1.Nc1ccc(Br)cn1.OB(O)c1ccc(NCC2CCCCC2)nc1 |
| InChI | InChI=1S/C12H19BN2O2.C12H17BrN2.C5H5BrN2/c16-13(17)11-6-7-12(15-9-11)14-8-10-4-2-1-3-5-10;13-11-6-7-12(15-9-11)14-8-10-4-2-1-3-5-10;6-4-1-2-5(7)8-3-4/h6-7,9-10,16-17H,1-5,8H2,(H,14,15);6-7,9-10H,1-5,8H2,(H,14,15);1-3H,(H2,7,8) |
| InChIKey | SJNUFDLZKXEREP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.31 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|