C25H28FN5O3S — CID 160853907
(3R)-3-[5-[[7-(cyclopropylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]methyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 160853907) has the molecular formula C25H28FN5O3S and a molecular weight of 497.60 g/mol. Its IUPAC name is (3R)-3-[5-[[7-(cyclopropylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]methyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[5-[[7-(cyclopropylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]methyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 160853907 |
| Molecular Formula | C25H28FN5O3S |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (3R)-3-[5-[[7-(cyclopropylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]methyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(Cc3ncnc4cc(OCC5CC5)cnc34)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C25H28FN5O3S/c1-24(2)23(27)31-25(3,13-35(24,32)33)18-8-16(6-7-19(18)26)9-20-22-21(30-14-29-20)10-17(11-28-22)34-12-15-4-5-15/h6-8,10-11,14-15H,4-5,9,12-13H2,1-3H3,(H2,27,31)/t25-/m0/s1 |
| InChIKey | NJEAZCDBPAXCIX-VWLOTQADSA-N |
| XLogP | 3.32 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |