C22H26N2O4S2 — CID 160854166
(3R)-3,6,6-trimethyl-3-(9-methyl-5,5-dioxo-6,11-dihydrobenzo[c][1]benzothiepin-2-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 160854166) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is (3R)-3,6,6-trimethyl-3-(9-methyl-5,5-dioxo-6,11-dihydrobenzo[c][1]benzothiepin-2-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3,6,6-trimethyl-3-(9-methyl-5,5-dioxo-6,11-dihydrobenzo[c][1]benzothiepin-2-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 160854166 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (3R)-3,6,6-trimethyl-3-(9-methyl-5,5-dioxo-6,11-dihydrobenzo[c][1]benzothiepin-2-yl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | Cc1ccc2c(c1)Cc1cc([C@]3(C)CS(=O)(=O)C(C)(C)C(N)=N3)ccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C22H26N2O4S2/c1-14-5-6-15-12-29(25,26)19-8-7-18(11-17(19)10-16(15)9-14)22(4)13-30(27,28)21(2,3)20(23)24-22/h5-9,11H,10,12-13H2,1-4H3,(H2,23,24)/t22-/m0/s1 |
| InChIKey | SJQOEFYIZMSYDD-QFIPXVFZSA-N |
| XLogP | 2.65 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |