C32H24F6Ge — CID 160856664
1,1-dimethyl-3,4-diphenyl-2,5-bis[2-(trifluoromethyl)phenyl]germole (PubChem CID 160856664) has the molecular formula C32H24F6Ge and a molecular weight of 595.14 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-diphenyl-2,5-bis[2-(trifluoromethyl)phenyl]germole.
| Compound Name | 1,1-dimethyl-3,4-diphenyl-2,5-bis[2-(trifluoromethyl)phenyl]germole |
|---|---|
| PubChem CID | 160856664 |
| Molecular Formula | C32H24F6Ge |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 1,1-dimethyl-3,4-diphenyl-2,5-bis[2-(trifluoromethyl)phenyl]germole |
| SMILES | C[Ge]1(C)C(c2ccccc2C(F)(F)F)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C32H24F6Ge/c1-39(2)29(23-17-9-11-19-25(23)31(33,34)35)27(21-13-5-3-6-14-21)28(22-15-7-4-8-16-22)30(39)24-18-10-12-20-26(24)32(36,37)38/h3-20H,1-2H3 |
| InChIKey | JEJHVNIQNDDTPM-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|