About 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine
2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 16086) has the molecular formula C8H15N5
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine.
Analyze 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine?
The IUPAC name of 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine (CID 16086) is 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine.
What is the SMILES notation for 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine?
The canonical SMILES for 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine is CCNc1nc(C)nc(NCC)n1.
What is the InChIKey of 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine?
The InChIKey is BLJHSTKKPDGEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5/c1-4-9-7-11-6(3)12-8(13-7)10-5-2/h4-5H2,1-3H3,(H2,9,10,11,12,13).
What are the key properties of 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine?
2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine has a molecular weight of 181.24 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-diethyl-6-methyl-1,3,5-triazine-2,4-diamine is sourced from PubChem (CID 16086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).