C14H21F7N2O — CID 160862261
N-[(1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl]-N-methyl-2-morpholin-4-ylethanamine (PubChem CID 160862261) has the molecular formula C14H21F7N2O and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[(1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl]-N-methyl-2-morpholin-4-ylethanamine.
| Compound Name | N-[(1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl]-N-methyl-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 160862261 |
| Molecular Formula | C14H21F7N2O |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl]-N-methyl-2-morpholin-4-ylethanamine |
| SMILES | CN(CCN1CCOCC1)CC1(F)CC(F)(F)C(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C14H21F7N2O/c1-22(2-3-23-4-6-24-7-5-23)10-11(15)8-12(16,17)14(20,21)13(18,19)9-11/h2-10H2,1H3 |
| InChIKey | ZANRUEPEHZSXKW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|