C17H17N3O2S2 — CID 160862869
5-[(5-pyrrolidin-2-ylnaphthalen-2-yl)sulfonylmethyl]-1,2,4-thiadiazole (PubChem CID 160862869) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 5-[(5-pyrrolidin-2-ylnaphthalen-2-yl)sulfonylmethyl]-1,2,4-thiadiazole.
| Compound Name | 5-[(5-pyrrolidin-2-ylnaphthalen-2-yl)sulfonylmethyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 160862869 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-[(5-pyrrolidin-2-ylnaphthalen-2-yl)sulfonylmethyl]-1,2,4-thiadiazole |
| SMILES | O=S(=O)(Cc1ncns1)c1ccc2c(C3CCCN3)cccc2c1 |
| InChI | InChI=1S/C17H17N3O2S2/c21-24(22,10-17-19-11-20-23-17)13-6-7-14-12(9-13)3-1-4-15(14)16-5-2-8-18-16/h1,3-4,6-7,9,11,16,18H,2,5,8,10H2 |
| InChIKey | ROOKUIZSZDDVHI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |