C13H14F3N3O4S — CID 160864585
morpholine;1,7-naphthyridin-4-yl trifluoromethanesulfonate (PubChem CID 160864585) has the molecular formula C13H14F3N3O4S and a molecular weight of 365.33 g/mol. Its IUPAC name is morpholine;1,7-naphthyridin-4-yl trifluoromethanesulfonate.
| Compound Name | morpholine;1,7-naphthyridin-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160864585 |
| Molecular Formula | C13H14F3N3O4S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | morpholine;1,7-naphthyridin-4-yl trifluoromethanesulfonate |
| SMILES | C1COCCN1.O=S(=O)(Oc1ccnc2cnccc12)C(F)(F)F |
| InChI | InChI=1S/C9H5F3N2O3S.C4H9NO/c10-9(11,12)18(15,16)17-8-2-4-14-7-5-13-3-1-6(7)8;1-3-6-4-2-5-1/h1-5H;5H,1-4H2 |
| InChIKey | SKYABFPIFABOAO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|