About tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate
tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate (PubChem CID 160865981) has the molecular formula C12H27NO6S
and a molecular weight of 313.42 g/mol. Its IUPAC name is tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate.
Molecular Properties
| Compound Name | tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate |
| PubChem CID | 160865981 |
| Molecular Formula | C12H27NO6S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC=O.CO[C@H](C)CNCCOS(C)(=O)=O |
| InChI | InChI=1S/C7H17NO4S.C5H10O2/c1-7(11-2)6-8-4-5-12-13(3,9)10;1-5(2,3)7-4-6/h7-8H,4-6H2,1-3H3;4H,1-3H3/t7-;/m1./s1 |
| InChIKey | SLCVCHYDQWMAHH-OGFXRTJISA-N |
| XLogP | 0.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate?
The IUPAC name of tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate (CID 160865981) is tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate.
What is the SMILES notation for tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate?
The canonical SMILES for tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate is CC(C)(C)OC=O.CO[C@H](C)CNCCOS(C)(=O)=O.
What is the InChIKey of tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate?
The InChIKey is SLCVCHYDQWMAHH-OGFXRTJISA-N. The full InChI is InChI=1S/C7H17NO4S.C5H10O2/c1-7(11-2)6-8-4-5-12-13(3,9)10;1-5(2,3)7-4-6/h7-8H,4-6H2,1-3H3;4H,1-3H3/t7-;/m1./s1.
What are the key properties of tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate?
tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate has a molecular weight of 313.42 g/mol, XLogP of 0.55, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;2-[[(2R)-2-methoxypropyl]amino]ethyl methanesulfonate is sourced from PubChem (CID 160865981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).