About 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one
3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one (PubChem CID 160866226) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one |
| PubChem CID | 160866226 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one |
| SMILES | CC(=O)c1cc2c(=O)c3cc(C)ccc3oc2nc1N |
| InChI | InChI=1S/C15H12N2O3/c1-7-3-4-12-10(5-7)13(19)11-6-9(8(2)18)14(16)17-15(11)20-12/h3-6H,1-2H3,(H2,16,17) |
| InChIKey | SWHHWBFOSCXQAD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one?
The IUPAC name of 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one (CID 160866226) is 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one.
What is the SMILES notation for 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one?
The canonical SMILES for 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one is CC(=O)c1cc2c(=O)c3cc(C)ccc3oc2nc1N.
What is the InChIKey of 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one?
The InChIKey is SWHHWBFOSCXQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c1-7-3-4-12-10(5-7)13(19)11-6-9(8(2)18)14(16)17-15(11)20-12/h3-6H,1-2H3,(H2,16,17).
What are the key properties of 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one?
3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one has a molecular weight of 268.27 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-amino-7-methylchromeno[2,3-b]pyridin-5-one is sourced from PubChem (CID 160866226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).