C22H24Cl2FN5OSi — CID 160866515
N-(2,6-dichloro-4-fluorophenyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 160866515) has the molecular formula C22H24Cl2FN5OSi and a molecular weight of 492.46 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 160866515 |
| Molecular Formula | C22H24Cl2FN5OSi |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-1-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1nccc1-n1ccc2c(Nc3c(Cl)cc(F)cc3Cl)nccc21 |
| InChI | InChI=1S/C22H24Cl2FN5OSi/c1-32(2,3)11-10-31-14-30-20(5-8-27-30)29-9-6-16-19(29)4-7-26-22(16)28-21-17(23)12-15(25)13-18(21)24/h4-9,12-13H,10-11,14H2,1-3H3,(H,26,28) |
| InChIKey | VUXKPHHTMFDDBX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|