C32H39NO6Si — CID 160866641
benzyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[[(4S)-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]propanoate (PubChem CID 160866641) has the molecular formula C32H39NO6Si and a molecular weight of 561.75 g/mol. Its IUPAC name is benzyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[[(4S)-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]propanoate.
| Compound Name | benzyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[[(4S)-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 160866641 |
| Molecular Formula | C32H39NO6Si |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | benzyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[[(4S)-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]propanoate |
| SMILES | CC1(C)OC[C@@H](C(=O)N[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C32H39NO6Si/c1-31(2,3)40(25-17-11-7-12-18-25,26-19-13-8-14-20-26)38-22-27(30(35)36-21-24-15-9-6-10-16-24)33-29(34)28-23-37-32(4,5)39-28/h6-20,27-28H,21-23H2,1-5H3,(H,33,34)/t27-,28-/m0/s1 |
| InChIKey | TZTJVQTXUJIGDT-NSOVKSMOSA-N |
| XLogP | 3.94 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|