About 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine
1-methoxy-4-methylpiperazine;1-methoxypyrrolidine (PubChem CID 160867647) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine.
Molecular Properties
| Compound Name | 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine |
| PubChem CID | 160867647 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine |
| SMILES | CON1CCCC1.CON1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2O.C5H11NO/c1-7-3-5-8(9-2)6-4-7;1-7-6-4-2-3-5-6/h3-6H2,1-2H3;2-5H2,1H3 |
| InChIKey | SLIKVJYCMQUXEP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine?
The IUPAC name of 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine (CID 160867647) is 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine.
What is the SMILES notation for 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine?
The canonical SMILES for 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine is CON1CCCC1.CON1CCN(C)CC1.
What is the InChIKey of 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine?
The InChIKey is SLIKVJYCMQUXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C5H11NO/c1-7-3-5-8(9-2)6-4-7;1-7-6-4-2-3-5-6/h3-6H2,1-2H3;2-5H2,1H3.
What are the key properties of 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine?
1-methoxy-4-methylpiperazine;1-methoxypyrrolidine has a molecular weight of 231.34 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-methylpiperazine;1-methoxypyrrolidine is sourced from PubChem (CID 160867647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).