C41H63NO5 — CID 160867801
ethyl (3R,4R,5S)-4-methyl-5-[[(2R,7Z,10Z,13Z,16Z,19Z,22Z)-2-methyl-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 160867801) has the molecular formula C41H63NO5 and a molecular weight of 649.96 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-methyl-5-[[(2R,7Z,10Z,13Z,16Z,19Z,22Z)-2-methyl-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-methyl-5-[[(2R,7Z,10Z,13Z,16Z,19Z,22Z)-2-methyl-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 160867801 |
| Molecular Formula | C41H63NO5 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 649.47 |
| IUPAC Name | ethyl (3R,4R,5S)-4-methyl-5-[[(2R,7Z,10Z,13Z,16Z,19Z,22Z)-2-methyl-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)C[C@@H](C)C(=O)N[C@H]1CC(C(=O)OCC)=C[C@@H](OC(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C41H63NO5/c1-7-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-36(43)30-33(5)40(44)42-38-31-35(41(45)46-10-4)32-39(34(38)6)47-37(8-2)9-3/h11-12,14-15,17-18,20-21,23-24,26-27,32-34,37-39H,7-10,13,16,19,22,25,28-31H2,1-6H3,(H,42,44)/b12-11-,15-14-,18-17-,21-20-,24-23-,27-26-/t33-,34-,38+,39-/m1/s1 |
| InChIKey | SLIYYLAPAQUIBY-FOGJEWNCSA-N |
| XLogP | 9.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|