C12H24O2 — CID 160868993
3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene (PubChem CID 160868993) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene.
| Compound Name | 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene |
|---|---|
| PubChem CID | 160868993 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene |
| SMILES | CC(=O)C(C)(C)C.COC(C)=C(C)C |
| InChI | InChI=1S/2C6H12O/c1-5(7)6(2,3)4;1-5(2)6(3)7-4/h2*1-4H3 |
| InChIKey | SLMYDJBUYZQWJZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|