About 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene
3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene (PubChem CID 160868993) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene.
Molecular Properties
| Compound Name | 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene |
| PubChem CID | 160868993 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene |
| SMILES | CC(=O)C(C)(C)C.COC(C)=C(C)C |
| InChI | InChI=1S/2C6H12O/c1-5(7)6(2,3)4;1-5(2)6(3)7-4/h2*1-4H3 |
| InChIKey | SLMYDJBUYZQWJZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene?
The IUPAC name of 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene (CID 160868993) is 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene.
What is the SMILES notation for 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene?
The canonical SMILES for 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene is CC(=O)C(C)(C)C.COC(C)=C(C)C.
What is the InChIKey of 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene?
The InChIKey is SLMYDJBUYZQWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O/c1-5(7)6(2,3)4;1-5(2)6(3)7-4/h2*1-4H3.
What are the key properties of 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene?
3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene has a molecular weight of 200.32 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-one;2-methoxy-3-methylbut-2-ene is sourced from PubChem (CID 160868993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).