About 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile
4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (PubChem CID 160869289) has the molecular formula C27H21N5O
and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 160869289 |
| Molecular Formula | C27H21N5O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1ccc(-c2cnc(Nc3ccc(C#N)cc3)nc2Oc2c(C)cc(C#N)cc2C)cc1 |
| InChI | InChI=1S/C27H21N5O/c1-17-4-8-22(9-5-17)24-16-30-27(31-23-10-6-20(14-28)7-11-23)32-26(24)33-25-18(2)12-21(15-29)13-19(25)3/h4-13,16H,1-3H3,(H,30,31,32) |
| InChIKey | SLNVLKAFBHGFKQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CID 160869289) is 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is Cc1ccc(-c2cnc(Nc3ccc(C#N)cc3)nc2Oc2c(C)cc(C#N)cc2C)cc1.
What is the InChIKey of 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The InChIKey is SLNVLKAFBHGFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N5O/c1-17-4-8-22(9-5-17)24-16-30-27(31-23-10-6-20(14-28)7-11-23)32-26(24)33-25-18(2)12-21(15-29)13-19(25)3/h4-13,16H,1-3H3,(H,30,31,32).
What are the key properties of 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile has a molecular weight of 431.50 g/mol, XLogP of 6.35, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-cyanoanilino)-5-(4-methylphenyl)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 160869289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).