C16H12F8 — CID 160870042
1,2,4,5-tetrafluoro-3,6-dimethylbenzene (PubChem CID 160870042) has the molecular formula C16H12F8 and a molecular weight of 356.26 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-dimethylbenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-dimethylbenzene |
|---|---|
| PubChem CID | 160870042 |
| Molecular Formula | C16H12F8 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-dimethylbenzene |
| SMILES | Cc1c(F)c(F)c(C)c(F)c1F.Cc1c(F)c(F)c(C)c(F)c1F |
| InChI | InChI=1S/2C8H6F4/c2*1-3-5(9)7(11)4(2)8(12)6(3)10/h2*1-2H3 |
| InChIKey | SLQFPFSNTXRTCD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|