About 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole
3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole (PubChem CID 160870825) has the molecular formula C17H33N3O
and a molecular weight of 295.47 g/mol. Its IUPAC name is 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole |
| PubChem CID | 160870825 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole |
| SMILES | C.C.Cc1ccn(C(C)C)n1.Cc1noc(C)c1C(C)C |
| InChI | InChI=1S/C8H13NO.C7H12N2.2CH4/c1-5(2)8-6(3)9-10-7(8)4;1-6(2)9-5-4-7(3)8-9;;/h5H,1-4H3;4-6H,1-3H3;2*1H4 |
| InChIKey | SLSQCXRHGMBOJW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole?
The IUPAC name of 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole (CID 160870825) is 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole.
What is the SMILES notation for 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole?
The canonical SMILES for 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole is C.C.Cc1ccn(C(C)C)n1.Cc1noc(C)c1C(C)C.
What is the InChIKey of 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole?
The InChIKey is SLSQCXRHGMBOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C7H12N2.2CH4/c1-5(2)8-6(3)9-10-7(8)4;1-6(2)9-5-4-7(3)8-9;;/h5H,1-4H3;4-6H,1-3H3;2*1H4.
What are the key properties of 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole?
3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole has a molecular weight of 295.47 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-propan-2-yl-1,2-oxazole;methane;3-methyl-1-propan-2-ylpyrazole is sourced from PubChem (CID 160870825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).