About (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium
(2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium (PubChem CID 160871505) has the molecular formula C24H26O3P+
and a molecular weight of 393.44 g/mol. Its IUPAC name is (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium |
| PubChem CID | 160871505 |
| Molecular Formula | C24H26O3P+ |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium |
| SMILES | CCc1cccc(-c2ccccc2)c1C(=O)c1c(C)cc(C)cc1C.O=[PH+]O |
| InChI | InChI=1S/C24H24O.HO2P/c1-5-19-12-9-13-21(20-10-7-6-8-11-20)23(19)24(25)22-17(3)14-16(2)15-18(22)4;1-3-2/h6-15H,5H2,1-4H3;3H/p+1 |
| InChIKey | MYLJSLUMMGULSD-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium?
The IUPAC name of (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium (CID 160871505) is (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium.
What is the SMILES notation for (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium?
The canonical SMILES for (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium is CCc1cccc(-c2ccccc2)c1C(=O)c1c(C)cc(C)cc1C.O=[PH+]O.
What is the InChIKey of (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium?
The InChIKey is MYLJSLUMMGULSD-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H24O.HO2P/c1-5-19-12-9-13-21(20-10-7-6-8-11-20)23(19)24(25)22-17(3)14-16(2)15-18(22)4;1-3-2/h6-15H,5H2,1-4H3;3H/p+1.
What are the key properties of (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium?
(2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium has a molecular weight of 393.44 g/mol, XLogP of 5.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6-phenylphenyl)-(2,4,6-trimethylphenyl)methanone;hydroxy(oxo)phosphanium is sourced from PubChem (CID 160871505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).