C33H31Cl2N6O5P — CID 160871684
4-[4-[2-[4-[(4-phenylphthalazin-1-yl)amino]phenoxy]-3-pyridinyl]pyrimidin-2-yl]butyl dihydrogen phosphate;dihydrochloride (PubChem CID 160871684) has the molecular formula C33H31Cl2N6O5P and a molecular weight of 693.53 g/mol. Its IUPAC name is 4-[4-[2-[4-[(4-phenylphthalazin-1-yl)amino]phenoxy]-3-pyridinyl]pyrimidin-2-yl]butyl dihydrogen phosphate;dihydrochloride.
| Compound Name | 4-[4-[2-[4-[(4-phenylphthalazin-1-yl)amino]phenoxy]-3-pyridinyl]pyrimidin-2-yl]butyl dihydrogen phosphate;dihydrochloride |
|---|---|
| PubChem CID | 160871684 |
| Molecular Formula | C33H31Cl2N6O5P |
| Molecular Weight | 693.53 g/mol |
| Exact Mass | 692.15 |
| IUPAC Name | 4-[4-[2-[4-[(4-phenylphthalazin-1-yl)amino]phenoxy]-3-pyridinyl]pyrimidin-2-yl]butyl dihydrogen phosphate;dihydrochloride |
| SMILES | Cl.Cl.O=P(O)(O)OCCCCc1nccc(-c2cccnc2Oc2ccc(Nc3nnc(-c4ccccc4)c4ccccc34)cc2)n1 |
| InChI | InChI=1S/C33H29N6O5P.2ClH/c40-45(41,42)43-22-7-6-14-30-34-21-19-29(37-30)28-13-8-20-35-33(28)44-25-17-15-24(16-18-25)36-32-27-12-5-4-11-26(27)31(38-39-32)23-9-2-1-3-10-23;;/h1-5,8-13,15-21H,6-7,14,22H2,(H,36,39)(H2,40,41,42);2*1H |
| InChIKey | WDYQGOFDHCNUPZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.53 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|