C20H16F6O4S — CID 160871698
(1R,2S)-6,8-difluoro-1-[(1S,2R)-2-fluoro-1-hydroxy-7-(trifluoromethylsulfonyl)-2,3-dihydro-1H-inden-4-yl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 160871698) has the molecular formula C20H16F6O4S and a molecular weight of 466.40 g/mol. Its IUPAC name is (1R,2S)-6,8-difluoro-1-[(1S,2R)-2-fluoro-1-hydroxy-7-(trifluoromethylsulfonyl)-2,3-dihydro-1H-inden-4-yl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1R,2S)-6,8-difluoro-1-[(1S,2R)-2-fluoro-1-hydroxy-7-(trifluoromethylsulfonyl)-2,3-dihydro-1H-inden-4-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 160871698 |
| Molecular Formula | C20H16F6O4S |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (1R,2S)-6,8-difluoro-1-[(1S,2R)-2-fluoro-1-hydroxy-7-(trifluoromethylsulfonyl)-2,3-dihydro-1H-inden-4-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | O=S(=O)(c1ccc([C@@H]2c3c(F)cc(F)cc3CC[C@@H]2O)c2c1[C@H](O)[C@H](F)C2)C(F)(F)F |
| InChI | InChI=1S/C20H16F6O4S/c21-9-5-8-1-3-14(27)17(16(8)12(22)6-9)10-2-4-15(31(29,30)20(24,25)26)18-11(10)7-13(23)19(18)28/h2,4-6,13-14,17,19,27-28H,1,3,7H2/t13-,14+,17+,19-/m1/s1 |
| InChIKey | SLVOXCWJIKZWRD-MCPREKNCSA-N |
| XLogP | 3.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |