C22H5F15S — CID 160873324
2,2,3-tris(2,3,4,5,6-pentafluorophenyl)thiolane (PubChem CID 160873324) has the molecular formula C22H5F15S and a molecular weight of 586.32 g/mol. Its IUPAC name is 2,2,3-tris(2,3,4,5,6-pentafluorophenyl)thiolane.
| Compound Name | 2,2,3-tris(2,3,4,5,6-pentafluorophenyl)thiolane |
|---|---|
| PubChem CID | 160873324 |
| Molecular Formula | C22H5F15S |
| Molecular Weight | 586.32 g/mol |
| Exact Mass | 585.99 |
| IUPAC Name | 2,2,3-tris(2,3,4,5,6-pentafluorophenyl)thiolane |
| SMILES | Fc1c(F)c(F)c(C2CCSC2(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H5F15S/c23-7-4(8(24)14(30)19(35)13(7)29)3-1-2-38-22(3,5-9(25)15(31)20(36)16(32)10(5)26)6-11(27)17(33)21(37)18(34)12(6)28/h3H,1-2H2 |
| InChIKey | CGPKSAMZIOIKSA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.32 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|