C24H18F3N5O — CID 160873598
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(1,5-naphthyridin-3-yl)methanone (PubChem CID 160873598) has the molecular formula C24H18F3N5O and a molecular weight of 449.44 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(1,5-naphthyridin-3-yl)methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(1,5-naphthyridin-3-yl)methanone |
|---|---|
| PubChem CID | 160873598 |
| Molecular Formula | C24H18F3N5O |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(1,5-naphthyridin-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CC[C@H]2N1C(=O)c1cnc2cccnc2c1 |
| InChI | InChI=1S/C24H18F3N5O/c1-31-23(12-7-16(25)21(27)17(26)8-12)15-10-14-4-5-20(22(15)30-31)32(14)24(33)13-9-19-18(29-11-13)3-2-6-28-19/h2-3,6-9,11,14,20H,4-5,10H2,1H3/t14-,20+/m0/s1 |
| InChIKey | SMBXGNWQENNXRI-VBKZILBWSA-N |
| XLogP | 4.35 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|