About ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid
ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid (PubChem CID 160873914) has the molecular formula C28H23F3N2O5
and a molecular weight of 524.50 g/mol. Its IUPAC name is ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid |
| PubChem CID | 160873914 |
| Molecular Formula | C28H23F3N2O5 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc2c(C(F)(F)F)cc(OCc3ccccc3)cc2[nH]1.O=C(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H16F3NO3.C9H7NO2/c1-2-25-18(24)17-10-14-15(19(20,21)22)8-13(9-16(14)23-17)26-11-12-6-4-3-5-7-12;11-9(12)8-5-6-3-1-2-4-7(6)10-8/h3-10,23H,2,11H2,1H3;1-5,10H,(H,11,12) |
| InChIKey | SMCZQWZINJZUDO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid?
The IUPAC name of ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid (CID 160873914) is ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid.
What is the SMILES notation for ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid?
The canonical SMILES for ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid is CCOC(=O)c1cc2c(C(F)(F)F)cc(OCc3ccccc3)cc2[nH]1.O=C(O)c1cc2ccccc2[nH]1.
What is the InChIKey of ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid?
The InChIKey is SMCZQWZINJZUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3NO3.C9H7NO2/c1-2-25-18(24)17-10-14-15(19(20,21)22)8-13(9-16(14)23-17)26-11-12-6-4-3-5-7-12;11-9(12)8-5-6-3-1-2-4-7(6)10-8/h3-10,23H,2,11H2,1H3;1-5,10H,(H,11,12).
What are the key properties of ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid?
ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid has a molecular weight of 524.50 g/mol, XLogP of 6.81, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-phenylmethoxy-4-(trifluoromethyl)-1H-indole-2-carboxylate;1H-indole-2-carboxylic acid is sourced from PubChem (CID 160873914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).